HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3,5-Dichlorobenzenesulfonyl chloride
3,5-DICHLOROBENZENE-1-SULFONYL CHLORIDE · BUTTPARK 95\57-48 · 3,5-Dichlorobenzenesulfonyl c · 3,5-DICHLOROBENZENESULFONYL CHLORIDE · 3,5-DICHLOROBENZENESULPHONYL CHLORIDE · 3,5-DichlorobenzenesulfonylChloride>Benzenesulfonyl chloride, 3,5-dichloro- · 3,5-Dichlorobenzenesulfonyl chloride,98% · 3,5-Dichlorobenzenesulfonyl chloride 97%
Identifikatoren & physikalische Daten
| CAS No. | 705-21-5 |
|---|---|
| Summenformel | C6H3Cl3O2S |
| Durchschnittliche Molmasse | 245,5 g/mol |
| Monoisotopische Masse | 243,89193338 g/mol |
| SMILES | O=S(=O)(Cl)c1cc(Cl)cc(Cl)c1 |
| InChIKey | RJSQINMKOSOUGT-UHFFFAOYSA-N |
| PubChem CID | 522388 |
| EC No. | 627-769-0 |
| DTXSID | DTXSID70334940 |
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 42,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 236 |
| Schmelzpunkt | 32-35 °C (lit.) |
| Siedepunkt | 83-84°C 0,1mm |
| Dichte | 1.636±0.06 g/cm3(Predicted) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Löslichkeit | soluble in Toluene |
| Aggregatzustand | powder to lump |
| Farbe | White to Light yellow |
| BRN | 1528657 |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H |
| InChIKey | RJSQINMKOSOUGT-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(c1)S(Cl)(=O)=O |
| CAS Datenbank | 705-21-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1759 8/PG 2 |
| Zollcode | 29049090 |
| R-Sätze (R) | 34 |
| Gefahrensymbole | C |
| hazard_note | Corrosive/Moisture Sensitive |
| Sicherheitshinweise (S) | 26-36/37/39-45 |
| Gefahrenklasse | 8Skin Corr. 1B |
| Verpackungsgruppe | II |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
Based on the study using 2,5-dichlorobenzenesulfonyl chloride, 3,5-dichlorobenzenesulfonyl chloride may act as a crosslinking agent for polyamides. It could react with –NH groups to enhance thermal stability (non-melting up to 1000°C), flame retardancy, and chemical resistance, though mechanical strength may decrease.[1]