HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
S-Nitroso-N-valeryl-D,L-penicillamine
SNVP · Rasagiline Impurity 30 · S-NITROSO-N-VALERYL-D,L-PENICILLAMINE · Valine, 3-(nitrosothio)-N-(1-oxopentyl)- · S-NITROSO-N-VALERYL-DL-PENICILLAMINE
Identifikatoren & physikalische Daten
| CAS No. | 225233-99-8 |
|---|---|
| Summenformel | C10H18N2O4S |
| Durchschnittliche Molmasse | 262,33 g/mol |
| Monoisotopische Masse | 262,09872823 g/mol |
| SMILES | CCCCC(=O)NC(C(=O)O)C(C)(C)SN=O |
| InChIKey | QCRZCAKMRYXQNT-UHFFFAOYSA-N |
| PubChem CID | 5232 |
| DTXSID | DTXSID30274459 |
Chemische & physikalische Eigenschaften
| XLogP | 1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 121 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 294 |
| Schmelzpunkt | 98-101°C |
| Dichte | 1.25±0.1 g/cm3(Predicted) |
| Lagerbedingungen | -86°C Freezer |
| Löslichkeit | Chloroform, Methanol |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 3.07±0.10(Predicted) |
| Farbe | Pale Green |
| Stabilität | Temperature Sensitive |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Exhibits higher lipophilicity and greater stability in solution than SNAP (Catalogue Number N522500). Its decompostion is accelerated by the presence of Cu(II) and cysteine