HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ethyl benzyl succinate
Benzyl ethyl succinate · Succinic acid benzyl ethyl ester · Butanedioic acid, 1-ethyl 4-(phenylmethyl) ester
Identifikatoren & physikalische Daten
| CAS No. | 106478-00-6 |
|---|---|
| Summenformel | C13H16O4 |
| Durchschnittliche Molmasse | 236,26 g/mol |
| Monoisotopische Masse | 236,10485899 g/mol |
| SMILES | CCOC(=O)CCC(=O)OCc1ccccc1 |
| InChIKey | MGWTXNMQOXXVRU-UHFFFAOYSA-N |
| PubChem CID | 528261 |
| DTXSID | DTXSID00335985 |
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 52,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 8 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 244 |
| Aggregatzustand | Solid |
| Farbe | White |
Anwendungen & Verwendung
Verwenden
Dibenzyl Succinate is an constituent in the synthesis of Succinobucol (S688775), an antioxidant and anti-inflammatory substance.