Identifikatoren & physikalische Daten
| CAS No. | 2548-85-8 |
|---|
| Summenformel | C22H34O2 |
|---|
| Durchschnittliche Molmasse | 330,5 g/mol |
|---|
| Monoisotopische Masse | 330,25588032 g/mol |
|---|
| SMILES | CC/C=C/CC/C=C/C/C=C/CC/C=C/CC/C=C/CCC(=O)O |
|---|
| InChIKey | PIFPCDRPHCQLSJ-WYIJOVFWSA-N |
|---|
| PubChem CID | 5282849 |
|---|
| ChEBI | CHEBI:170127 |
|---|
| EC No. | 219-832-2 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 6,1 |
|---|
| Polarare Oberfläche (TPSA) | 37,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 15 |
|---|
| Schwere Atome | 24 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 425 |
|---|
| Lipide | Fatty Acyls [FA] -> Fatty Acids and Conjugates [FA01] -> Unsaturated fatty acids [FA0103] |
|---|
Sicherheit & Vorschriften
| Regulatorische Informationen | 4,8,12,15,19-Docosapentaenoic acid: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|
