HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
CoQ4
Q-4 · Nsc266773 · COENZYME Q4 · UBIQUINONE-4 · Ubiquinone Q4 · UBIQUINONE-20 · Isatin Impurity 4 · Coenzyme Q4[C2470]
Identifikatoren & physikalische Daten
| CAS No. | 4370-62-1 |
|---|---|
| Summenformel | C29H42O4 |
| Durchschnittliche Molmasse | 454,6 g/mol |
| Monoisotopische Masse | 454,30830982 g/mol |
| SMILES | COC1=C(OC)C(=O)C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)=C(C)C1=O |
| InChIKey | XGCJRRDNIMSYNC-INVBOZNNSA-N |
| PubChem CID | 5283545 |
| ChEMBL | CHEMBL407116 |
| ChEBI | CHEBI:149479 |
| DTXSID | DTXSID901345979 |
Chemische & physikalische Eigenschaften
| XLogP | 8,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 52,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 13 |
| Schwere Atome | 33 |
| Formalladung | 0 |
| Komplexität | 900 |
| Lipide | Lipids -> Prenol Lipids [PR] -> Quinones and hydroquinones [PR02] -> Ubiquinones [PR0201] |
| Physical Description | Solid |
| Siedepunkt | 584.1±50.0 °C(Predicted) |
| Dichte | 1.01±0.1 g/cm3(Predicted) |
| Lagerbedingungen | -20°C |
| Aggregatzustand | Liquid |
| Farbe | Colorless to light yellow |
| BRN | 2066531 |
| InChIKey | MDLQEORKYVBTDV-INVBOZNNSA-N |
| SMILES | COC1C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)C)=C(C)C1=O |
Sicherheit & Vorschriften
| F | 8-10 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
Coenzyme Q4 (CoQ4) is a 4 isoprenyl group member of a family of ubiquinones that share a quinine chemical group but differ in the number of isoprenyl chemical subunits in their tail. The CoQ compounds are lipid soluble components of cell membranes where they perform multiple functions such as electron and proton transport. The most well studied CoQ compound is CoQ10. CoQ4 is frequently used in comparison studies on the effect of isoprenyl chain length on CoQ functions or distribution.