HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(1R,7aR)-7-({[2,3-dihydroxy-2-(1-methylethyl)butanoyl]oxy}methyl)-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl (2E)-2-methylbut-2-enoate
symphytine · 2-Butenoic acid, 2-methyl-, (1R,7aR)-7-[[(2S,3S)-2,3-dihydroxy-2-(1-methylethyl)-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl ester, (2E)-
![Molekülstruktur von (1R,7aR)-7-({[2,3-dihydroxy-2-(1-methylethyl)butanoyl]oxy}methyl)-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl (2E)-2-methylbut-2-enoate](/img/chemical/5284460.png)
Identifikatoren & physikalische Daten
| CAS No. | 22571-95-5 |
|---|---|
| Summenformel | C20H31NO6 |
| Durchschnittliche Molmasse | 381,5 g/mol |
| Monoisotopische Masse | 381,21513771 g/mol |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1CCN2CC=C(COC(=O)C(O)(C(C)C)C(C)O)[C@H]12 |
| InChIKey | MVWPTZQHBOWRTF-OEQXRFFVSA-N |
| PubChem CID | 5284460 |
| DTXSID | DTXSID1021297 |
Chemische & physikalische Eigenschaften
| XLogP | 1,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 96,3 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 7 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 27 |
| Formalladung | 0 |
| Komplexität | 640 |
| Siedepunkt | 508.85°C (rough estimate) |
| Dichte | 1.2168 (rough estimate) |
| Brechungsindex | 1.5614 (estimate) |
| pKa (Säurekonstante) | 12.59±0.29(Predicted) |
Sicherheit & Vorschriften
| UN-Transportnummer | 1544 |
|---|---|
| Gefahrenklasse | 6.1(b) |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Beschreibung
This pyrrolizidine alkaloid occurs in the roots of Symphytum officinale Linn. and is difficult to crystallize. The above structure has been proposed on the basis of chemical degradation and spectroscopic evidence.