HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
7,10,13-Hexadecatrienoic acid
Roughanic acid · 7(Z), 10(Z),13(Z)-HEXADECATRIENOIC ACID · (7Z,10Z,13Z)-Hexadeca-7,10,13-trienoic acid · 7,10,13-Hexadecatrienoic acid, (7Z,10Z,13Z)-
Identifikatoren & physikalische Daten
| CAS No. | 1569300-52-2 |
|---|---|
| Summenformel | C16H26O2 |
| Durchschnittliche Molmasse | 250,38 g/mol |
| Monoisotopische Masse | 250,19328007 g/mol |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)O |
| InChIKey | KBGYPXOSNDMZRV-PDBXOOCHSA-N |
| PubChem CID | 5312428 |
| ChEBI | CHEBI:22340 |
| DTXSID | DTXSID501377033 |
Chemische & physikalische Eigenschaften
| XLogP | 4,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 11 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 275 |
| Lipide | Fatty Acyls [FA] -> Fatty Acids and Conjugates [FA01] -> Unsaturated fatty acids [FA0103] |
| Collision Cross Section | 160.8 Ų [M-H]- [CCS Type: TIMSMethod: single field calibrated] |
| Siedepunkt | 349.8±21.0 °C(Predicted) |
| Dichte | 0.933±0.06 g/cm3(Predicted) |
| Löslichkeit | Ethanol: soluble |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 4.76±0.10(Predicted) |
| Farbe | Colorless to light yellow |
Anwendungen & Verwendung
Verwenden
7(Z),10(Z),13(Z)-Hexadecatrienoic Acid, is a polysaturated fatty acid, also shown to exist in Southern Australian seaweeds, a promising resource for omega-3 fatty acids.