HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 531925Erstellt: 1. November 2026
N-(3-chlorophenyl)thiophene-2-carboxamide
N-(3-chlorophenyl)-2-thiophenecarboxamide
https://huagongshe.com/de/chemical/531925
Identifikatoren & physikalische Daten
| CAS No. | 79822-82-5 |
|---|
| Summenformel | C11H8ClNOS |
|---|
| Durchschnittliche Molmasse | 237,71 g/mol |
|---|
| Monoisotopische Masse | 237,0015127 g/mol |
|---|
| SMILES | O=C(Nc1cccc(Cl)c1)c1cccs1 |
|---|
| InChIKey | FHTIWIPMVNMNHO-UHFFFAOYSA-N |
|---|
| PubChem CID | 531925 |
|---|
| EC No. | 146-242-1 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|
| Polarare Oberfläche (TPSA) | 57,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 237 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
