HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 54677756Erstellt: 2. November 2026
3-Phenyl-2,4-quinolinediol
3-phenyl-quinoline-2,4-diol · 2,4-Dihydroxy-3-phenylquinoline · 2(1H)-Quinolinone, 4-hydroxy-3-phenyl-
https://huagongshe.com/de/chemical/54677756
Identifikatoren & physikalische Daten
| CAS No. | 14933-29-0 |
|---|
| Summenformel | C15H11NO2 |
|---|
| Durchschnittliche Molmasse | 237,25 g/mol |
|---|
| Monoisotopische Masse | 237,07897859 g/mol |
|---|
| SMILES | O=c1[nH]c2ccccc2c(O)c1-c1ccccc1 |
|---|
| InChIKey | WNISVGSZMGXKHE-UHFFFAOYSA-N |
|---|
| PubChem CID | 54677756 |
|---|
| ChEMBL | CHEMBL324519 |
|---|
| DTXSID | DTXSID90164221 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|
| Polarare Oberfläche (TPSA) | 49,3 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 369 |
|---|
| LogP (Verteilungskoeffizient) | 1.12 |
|---|
| Löslichkeit | 17.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
| Schmelzpunkt | 318 °C |
|---|
| Siedepunkt | 484.6±45.0 °C(Predicted) |
|---|
| Dichte | 1.323±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 4.50±1.00(Predicted) |
|---|
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
