HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Losulazine
Losulazine · 1-[(4-Fluorophenyl)sulfonyl]-4-[4-[[7-(trifluoromethyl)quinolin-4-yl]amino]benzoyl]piperazine · Methanone, [4-[(4-fluorophenyl)sulfonyl]-1-piperazinyl][4-[[7-(trifluoromethyl)-4-quinolinyl]amino]phenyl]-
Identifikatoren & physikalische Daten
| CAS No. | 72141-57-2 |
|---|---|
| Summenformel | C27H22F4N4O3S |
| Durchschnittliche Molmasse | 558,5 g/mol |
| Monoisotopische Masse | 558,1348744 g/mol |
| SMILES | O=C(c1ccc(Nc2ccnc3cc(C(F)(F)F)ccc23)cc1)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChIKey | SYJKIRZBDWNJSB-UHFFFAOYSA-N |
| PubChem CID | 54750 |
| ChEMBL | CHEMBL287419 |
| DTXSID | DTXSID20868088 |
Chemische & physikalische Eigenschaften
| XLogP | 4,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 91 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 10 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 39 |
| Formalladung | 0 |
| Komplexität | 938 |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Losulazine is used in the preparation of 7-(Trifluoromethyl)-4-aminoquinoline hypotensives: novel peripheral sympatholytics.