HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,1-Bis(1,1-dimethylethoxy)-N,N,N-trimethylamin
1,1-di-tert-butoxy-N,N-dimethylmethanamine · N,N-DIMETHYLFORMAMIDE DI-TERT-BUTYL ACETAL · [bis(tert-butoxy)methyl]dimethylamine · N,N-Di-tert-butoxytrimethylamine · 1,1-DI-TERT-BUTOXYTRIMETHYLAMINE · Di-tert-butoxyMethyl-diMethyl-aMine · Di-tert-butoxy(dimethylamino)methane · N,N-Dimethyldi-tert-butoxymethanamine
Identifikatoren & physikalische Daten
| CAS No. | 36805-97-7 |
|---|---|
| Summenformel | C11H25NO2 |
| Durchschnittliche Molmasse | 203,32 g/mol |
| Monoisotopische Masse | 203,18852904 g/mol |
| SMILES | CN(C)C(OC(C)(C)C)OC(C)(C)C |
| InChIKey | DBNQIOANXZVWIP-UHFFFAOYSA-N |
| PubChem CID | 547712 |
| EC No. | 253-222-7 |
| DTXSID | DTXSID10190284 |
| Lokaler Name | 1,1-Bis(1,1-dimethylethoxy)-N,N,N-trimethylamin |
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 21,7 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 149 |
| Siedepunkt | 56-57 °C8 mm Hg(lit.) |
| Dichte | 0.848 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.413(lit.) |
| Flammpunkt | 93 °F |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| Löslichkeit | Miscible with toluene and benzene. |
| Aggregatzustand | clear liquid |
| pKa (Säurekonstante) | 5.34±0.50(Predicted) |
| Farbe | Colorless to Almost colorless |
| Wichte | 0.848 |
| BRN | 969629 |
| InChI | InChI=1S/C11H25NO2/c1-10(2,3)13-9(12(7)8)14-11(4,5)6/h9H,1-8H3 |
| InChIKey | DBNQIOANXZVWIP-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(OC(C)(C)C)N(C)C |
| CAS Datenbank | 36805-97-7(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (98%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (98%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1993 3/PG 3 |
| Zollcode | 29221990 |
| R-Sätze (R) | 10-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
Reagent used for the preparation of indolizines via intermolecular cyclization of picolinium salts.