HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 550340Erstellt: 4. November 2026
2,3,3,3-Tetrafluoro-2-(trifluoromethoxy)propanamide
2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanamide · Propanamide, 2,3,3,3-tetrafluoro-2-(trifluoromethoxy)-
https://huagongshe.com/de/chemical/550340
Identifikatoren & physikalische Daten
| CAS No. | 67710-48-9 |
|---|
| Summenformel | C4H2F7NO2 |
|---|
| Durchschnittliche Molmasse | 229,05 g/mol |
|---|
| Monoisotopische Masse | 228,99737544 g/mol |
|---|
| SMILES | NC(=O)C(F)(OC(F)(F)F)C(F)(F)F |
|---|
| InChIKey | RODHNODFUBONAV-UHFFFAOYSA-N |
|---|
| PubChem CID | 550340 |
|---|
| EC No. | 103-448-6 |
|---|
| DTXSID | DTXSID20896482 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|
| Polarare Oberfläche (TPSA) | 52,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 9 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 233 |
|---|
| PFAS | PFAS -> OECD CategoryPFAS -> Other/unspecified |
|---|
| EPA chemische Informationen | 2,3,3,3-Tetrafluoro-2-(trifluoromethoxy)propanamide (67710-48-9) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
