HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-[(Dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol
Cyclohexanol, 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)- · 2-[(Dimethylamino)methyl]-1-(3-methoxyphenyl)-1-cyclohexanol · 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol · Tramadol EP Impurity AQ: What is Tramadol EP Impurity A Q: What is the CAS Number of Tramadol EP Impurity A Q: What is the storage condition of Tramadol EP Impurity A Q: What are the applications of Tramadol EP Impurity A
![Molekülstruktur von 2-[(Dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol](/img/chemical/5523.png)
Identifikatoren & physikalische Daten
| CAS No. | 2914-77-4 |
|---|---|
| Summenformel | C16H25NO2 |
| Durchschnittliche Molmasse | 263,37 g/mol |
| Monoisotopische Masse | 263,18852904 g/mol |
| SMILES | COc1cccc(C2(O)CCCCC2CN(C)C)c1 |
| InChIKey | TVYLLZQTGLZFBW-UHFFFAOYSA-N |
| PubChem CID | 5523 |
| ChEBI | CHEBI:75722 |
| EC No. | 220-831-4 |
| DTXSID | DTXSID00860388 |
| Lokaler Name | 2-[(Dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol |
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 32,7 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 282 |
| Arzneimittel | Pharmaceuticals |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Siedepunkt | 406.62°C (rough estimate) |
| Dichte | 0.9903 (rough estimate) |
| Brechungsindex | 1.4909 (estimate) |
| pKa (Säurekonstante) | 14.47±0.40(Predicted) |