Identifikatoren & physikalische Daten
| CAS No. | 40489-45-0 |
|---|
| Summenformel | C18H19NO5 |
|---|
| Durchschnittliche Molmasse | 329,3 g/mol |
|---|
| Monoisotopische Masse | 329,12632271 g/mol |
|---|
| SMILES | O=C(NC(CO)C(=O)OCc1ccccc1)OCc1ccccc1 |
|---|
| InChIKey | MHHDPGHZHFJLBZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 562178 |
|---|
| ChEMBL | CHEMBL1481421 |
|---|
| DTXSID | DTXSID50340160 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|
| Polarare Oberfläche (TPSA) | 84,9 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 9 |
|---|
| Schwere Atome | 24 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 389 |
|---|
| Löslichkeit | >49.4 [ug/mL] (The mean of the results at pH 7.4) |
|---|
