HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluornonyl)oxiran
3H · T8-EP · DAIKIN E-1830 · Perfluorooctylpropyleneoxide · Perfluorooctyl propyl epoxide · (1H,1H-Perfluorononyl)oxirane · 3-(PERFLUORO-N-OCTYL)PROPENOXIDE · 3-(Perfluorooctyl)propyl epoxide
Identifikatoren & physikalische Daten
| CAS No. | 38565-53-6 |
|---|---|
| Summenformel | C8F17CH2C2OH3 |
| Durchschnittliche Molmasse | 476,13 g/mol |
| Monoisotopische Masse | 476,00689452 g/mol |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1CO1 |
| InChIKey | HMXSIEIEXLGIET-UHFFFAOYSA-N |
| PubChem CID | 571982 |
| EC No. | 254-006-5 |
| DTXSID | DTXSID50880415 |
| Lokaler Name | (2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluornonyl)oxiran |
Chemische & physikalische Eigenschaften
| XLogP | 6,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 12,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 18 |
| Frei drehbare Bindungen | 8 |
| Schwere Atome | 29 |
| Formalladung | 0 |
| Komplexität | 617 |
| PFAS | PFAS -> non-polymerPFAS -> Fluorotelomer based substancesPFAS -> Other/unspecifiedPFAS -> OECD Category |
| Schmelzpunkt | 76-78 °C |
| Siedepunkt | 87 °C/19 mmHg (lit.) |
| Dichte | 1.712 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.32(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Storage temp. 2-8°C |
| Löslichkeit | Chloroform (Soluble), Methanol (Slightly) |
| Aggregatzustand | clear liquid |
| Wichte | 1.714 |
| Farbe | Colorless to Almost colorless |
| InChI | InChI=1S/C11H5F17O/c12-4(13,1-3-2-29-3)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h3H,1-2H2 |
| InChIKey | HMXSIEIEXLGIET-UHFFFAOYSA-N |
| SMILES | O1CC1CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS Datenbank | 38565-53-6(CAS DataBase Reference) |
| EPA chemische Informationen | 3-(Perfluorooctyl)-1,2-propenoxide (38565-53-6) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302+H332 (20%): Harmful if swallowed or if inhaled [Warning Acute toxicity, oralacute toxicity, inhalation]P203, P260, P261, P263, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (20%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29109000 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| Gefahrenklasse | Acute Tox. 4 InhalationAcute Tox. 4 OralCarc. 2Eye Dam. 1Lact.Repr. 1BSTOT RE 1 |
Anwendungen & Verwendung
Verwenden
3-(Perfluorooctyl)-1,2-propenoxide is a fluorinated epoxide with antibacterial properties.