HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Phenylimidazolidine-2,4,5-trione
1-PHENYL-2,4,5-IMIDAZOLIDINETRIONE
Identifikatoren & physikalische Daten
| CAS No. | 2211-33-8 |
|---|---|
| Summenformel | C9H6N2O3 |
| Durchschnittliche Molmasse | 190,16 g/mol |
| Monoisotopische Masse | 190,03784206 g/mol |
| SMILES | O=C1NC(=O)N(c2ccccc2)C1=O |
| InChIKey | AVIPDXGMHBJIGG-UHFFFAOYSA-N |
| PubChem CID | 577259 |
| ChEMBL | CHEMBL1555883 |
| EC No. | 669-372-5 |
| DTXSID | DTXSID40341949 |
Chemische & physikalische Eigenschaften
| XLogP | 0,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,5 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 294 |
| LogP (Verteilungskoeffizient) | 0.6 |
| Löslichkeit | >28.5 [ug/mL] (The mean of the results at pH 7.4) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P280, P305+P351+P338, and P337+P317 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Eye Irrit. 2A (100%) |
| Alarmwort | Warnung |
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H319 |
Anwendungen & Verwendung
Verwenden
1-Phenylimidazolidine-2,4,5-trione can be used as anticancer agents.