HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 577479Erstellt: 3. November 2026
N-(2,4-Dimethylphenyl)-2-nitrobenzamide
N-(2,4-dimethylphenyl)-2-nitrobenzamide
https://huagongshe.com/de/chemical/577479
Identifikatoren & physikalische Daten
| CAS No. | 102630-95-5 |
|---|
| Summenformel | C15H14N2O3 |
|---|
| Durchschnittliche Molmasse | 270,28 g/mol |
|---|
| Monoisotopische Masse | 270,10044231 g/mol |
|---|
| SMILES | Cc1ccc(NC(=O)c2ccccc2[N+](=O)[O-])c(C)c1 |
|---|
| InChIKey | WGMMCHJMOXWGPL-UHFFFAOYSA-N |
|---|
| PubChem CID | 577479 |
|---|
| ChEMBL | CHEMBL560086 |
|---|
| EC No. | 169-490-2 |
|---|
| DTXSID | DTXSID101279807 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,3 |
|---|
| Polarare Oberfläche (TPSA) | 74,9 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 367 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P280, P305+P351+P338, and P337+P317 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
|---|
