HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4,6-Dichloro-3-methylpyridazine
3,5-Dichloro-6-methylpyridazine · 4,6-dichloro-3-Methylpyridazine · Pyridazine, 4,6-dichloro-3-methyl-
Identifikatoren & physikalische Daten
| CAS No. | 68240-43-7 |
|---|---|
| Summenformel | C5H4Cl2N2 |
| Durchschnittliche Molmasse | 163 g/mol |
| Monoisotopische Masse | 161,97515349 g/mol |
| SMILES | Cc1nnc(Cl)cc1Cl |
| InChIKey | SWLRTVHQASOVRZ-UHFFFAOYSA-N |
| PubChem CID | 58717049 |
| EC No. | 807-544-5 |
| DTXSID | DTXSID50729739 |
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 25,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 99 |
| Siedepunkt | 295.1±35.0 °C(Predicted) |
| Dichte | 1.404±0.06 g/cm3(Predicted) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| pKa (Säurekonstante) | 0.02±0.10(Predicted) |
| InChI | InChI=1S/C5H4Cl2N2/c1-3-4(6)2-5(7)9-8-3/h2H,1H3 |
| InChIKey | SWLRTVHQASOVRZ-UHFFFAOYSA-N |
| SMILES | C1(C)=NN=C(Cl)C=C1Cl |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (80%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P319, P321, P330, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (80%) |
| Zollcode | 2933998090 |
Anwendungen & Verwendung
Verwenden
4,6-Dichloro-3-methylpyridazine is a reagent in the preparation of URAT1 inhibitors which are used in the treatment of uric acid related disorders.