HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 587792Erstellt: 26. Oktober 2026
4-Fluoro-3-hydroxybenzaldehyde
Benzaldehyde, 4-fluoro-3-hydroxy- · 4-fluoro-3-hydroxy-benzaldehyde
https://huagongshe.com/de/chemical/587792
Identifikatoren & physikalische Daten
| CAS No. | 103438-85-3 |
|---|
| Summenformel | C7H5FO2 |
|---|
| Durchschnittliche Molmasse | 140,11 g/mol |
|---|
| Monoisotopische Masse | 140,02735762 g/mol |
|---|
| SMILES | O=Cc1ccc(F)c(O)c1 |
|---|
| InChIKey | DOULGHINSFURSM-UHFFFAOYSA-N |
|---|
| PubChem CID | 587792 |
|---|
| EC No. | 816-992-0 |
|---|
| DTXSID | DTXSID50343156 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,1 |
|---|
| Polarare Oberfläche (TPSA) | 37,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 10 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 127 |
|---|
| Schmelzpunkt | 109-110 °C |
|---|
| Siedepunkt | 229.6±20.0 °C(Predicted) |
|---|
| Dichte | 1.350±0.06 g/cm3(Predicted) |
|---|
| Lagerbedingungen | 2-8°C, stored under nitrogen |
|---|
| pKa (Säurekonstante) | 7.99±0.10(Predicted) |
|---|
| Aggregatzustand | solid |
|---|
| Farbe | Beige |
|---|
| InChI | InChI=1S/C7H5FO2/c8-6-2-1-5(4-9)3-7(6)10/h1-4,10H |
|---|
| InChIKey | DOULGHINSFURSM-UHFFFAOYSA-N |
|---|
| SMILES | C(=O)C1=CC=C(F)C(O)=C1 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Zollcode | 2913000090 |
|---|
