Identifikatoren & physikalische Daten
| CAS No. | 7101-92-0 |
|---|
| Summenformel | C16H14N2O2S |
|---|
| Durchschnittliche Molmasse | 298,4 g/mol |
|---|
| Monoisotopische Masse | 298,07759887 g/mol |
|---|
| SMILES | Cc1ccc(S(=O)(=O)Nc2cnc3ccccc3c2)cc1 |
|---|
| InChIKey | NUNOQWFQZCHJDF-UHFFFAOYSA-N |
|---|
| PubChem CID | 588682 |
|---|
| ChEMBL | CHEMBL1299349 |
|---|
| DTXSID | DTXSID801271747 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|
| Polarare Oberfläche (TPSA) | 67,4 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 438 |
|---|
| Löslichkeit | >44.8 [ug/mL] (The mean of the results at pH 7.4) |
|---|
