HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Camylofin
camylofine · camylofin · CAMYLOFIN DIHYDROCHLORIDE · adopon · avacan · avadyl · avocan · navadyl
Identifikatoren & physikalische Daten
| CAS No. | 54-30-8 |
|---|---|
| Summenformel | C19H32N2O2 |
| Durchschnittliche Molmasse | 320,5 g/mol |
| Monoisotopische Masse | 320,24637827 g/mol |
| SMILES | CCN(CC)CCNC(C(=O)OCCC(C)C)c1ccccc1 |
| InChIKey | RYOOHIUJEJZCFT-UHFFFAOYSA-N |
| PubChem CID | 5902 |
| ChEMBL | CHEMBL253592 |
| ChEBI | CHEBI:95216 |
| EC No. | 200-202-0 |
| DTXSID | DTXSID7046415 |
| Lokaler Name | Camylofin |
Chemische & physikalische Eigenschaften
| XLogP | 3,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 41,6 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 12 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 310 |
| Schmelzpunkt | 25°C |
| Siedepunkt | bp1.5 174-178°bp4 165-180° |
| Dichte | 1.0539 (rough estimate) |
| Brechungsindex | 1.5020 (estimate) |
| Lagerbedingungen | Store at -20°C |
| Löslichkeit | Soluble in DMSO |
| pKa (Säurekonstante) | 10.02±0.25(Predicted) |
| Farbe | Pale-yellow oil |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| RTECS-Nr. | MB9625000 |
| R-Sätze (R) | 22 |
| Toxizität | LD50 orl-mus: 760 mg/kg DMWOAX 76,479,51 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36 |
Anwendungen & Verwendung
Verwenden
anticholinergic