HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Benzoic acid, 4-nitro-, 2-ethylhexyl ester
4-Nitro benzoic acid 2-ethyl-hexyl ester · Benzoic acid, 4-nitro-, 2-ethylhexyl ester
Identifikatoren & physikalische Daten
| CAS No. | 16397-70-9 |
|---|---|
| Summenformel | C15H21NO4 |
| Durchschnittliche Molmasse | 279,33 g/mol |
| Monoisotopische Masse | 279,14705815 g/mol |
| SMILES | CCCCC(CC)COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChIKey | NPSJHQMIVNJLNN-UHFFFAOYSA-N |
| PubChem CID | 591313 |
| ChEMBL | CHEMBL5267658 |
| DTXSID | DTXSID80343664 |
Chemische & physikalische Eigenschaften
| XLogP | 5,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 72,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 8 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 305 |
| Siedepunkt | 390.6±25.0 °C(Predicted) |
| Dichte | 1.095±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Store at room temperature |
| Löslichkeit | DMSO (Sparingly), Methanol (Slightly) |
| Aggregatzustand | Oil |
| Farbe | Light Yellow |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H341 |
Anwendungen & Verwendung
Verwenden
2-Ethylhexyl 4-Nitrobenzoate is an intermediate in the synthesis of 2-Ethylhexyl-4-aminobenzoate (E918745) which is an impurity in the synthesis of Ethylhexyl Triazone (E918810), used in sunscreen formulations as a UV filter to block out harmful ultraviolet light.