HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 592111Erstellt: 2. November 2026
N-(3-Chlorophenyl)veratrylamine
N-(3-Chlorophenyl)veratrylamine · Benzenemethanamine, N-(3-chlorophenyl)-3,4-dimethoxy-
https://huagongshe.com/de/chemical/592111
Identifikatoren & physikalische Daten
| CAS No. | 19020-05-4 |
|---|
| Summenformel | C15H16ClNO2 |
|---|
| Durchschnittliche Molmasse | 277,74 g/mol |
|---|
| Monoisotopische Masse | 277,0869564 g/mol |
|---|
| SMILES | COc1ccc(CNc2cccc(Cl)c2)cc1OC |
|---|
| InChIKey | VKEREXRSVOKRAK-UHFFFAOYSA-N |
|---|
| PubChem CID | 592111 |
|---|
| EC No. | 633-676-6 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|
| Polarare Oberfläche (TPSA) | 30,5 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 265 |
|---|
| Schmelzpunkt | 123 °C |
|---|
| Siedepunkt | 408.8±35.0 °C(Predicted) |
|---|
| Dichte | 1.209±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 2.83±0.25(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P317, P305+P354+P338, P317, P330, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Achtung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
