HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,3-Dimethyl-4-nitroanisol
1-Methoxy-2,3-dimethyl-4-nitrobenzene · 3-Methoxy-6-ni · 3-METHOXY-6-NITRO-O-XYLENE · 4-Nitro-2,3-dimethylanisole · 2,3-DiMethy-4-nitrolanisole · 2,3-DIMETHYL-P-NITROANISOLE · 2,3-Dimethyl-4-nitroanisole · 2,3-Dimethyl-4-nitroanisole>2,3-Dimethyl-4-nitroanisole 95%
Identifikatoren & physikalische Daten
| CAS No. | 81029-03-0 |
|---|---|
| Summenformel | C9H11NO3 |
| Durchschnittliche Molmasse | 181,19 g/mol |
| Monoisotopische Masse | 181,07389321 g/mol |
| SMILES | COc1ccc([N+](=O)[O-])c(C)c1C |
| InChIKey | DUBFMQLUMHKYOX-UHFFFAOYSA-N |
| PubChem CID | 596465 |
| EC No. | 279-674-5 |
| DTXSID | DTXSID00230865 |
| Lokaler Name | 2,3-Dimethyl-4-nitroanisol |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 55,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 190 |
| Schmelzpunkt | 70-73 °C(lit.) |
| Siedepunkt | 314.29°C (rough estimate) |
| Dichte | 1.2375 (rough estimate) |
| Brechungsindex | 1.5270 (estimate) |
| Lagerbedingungen | Store at room temperature |
| InChI | 1S/C9H11NO3/c1-6-7(2)9(13-3)5-4-8(6)10(11)12/h4-5H,1-3H3 |
| InChIKey | DUBFMQLUMHKYOX-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(C)c1C)[N+]([O-])=O |
| CAS Datenbank | 81029-03-0(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29093090 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-36/37/39 |
| Lagerklasse | 13 - Non Combustible Solids |
Anwendungen & Verwendung
Verwenden
2,3-Dimethyl-4-nitroanisole was used:as starting material in the synthesis of conformationally restricted derivatives of lavendustin Ain the synthesis of 1,4-piperazine-2,5-diones