HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 596995Erstellt: 3. November 2026
4-(5-Phenyl-1,3,4-oxadiazol-2-yl)benzoic acid
Benzoic acid, 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-
https://huagongshe.com/de/chemical/596995
Identifikatoren & physikalische Daten
| CAS No. | 85292-45-1 |
|---|
| Summenformel | C15H10N2O3 |
|---|
| Durchschnittliche Molmasse | 266,25 g/mol |
|---|
| Monoisotopische Masse | 266,06914219 g/mol |
|---|
| SMILES | O=C(O)c1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
|---|
| InChIKey | KJSLGQIRTJNTKD-UHFFFAOYSA-N |
|---|
| PubChem CID | 596995 |
|---|
| ChEMBL | CHEMBL1613018 |
|---|
| EC No. | 845-281-8 |
|---|
| DTXSID | DTXSID40344455 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|
| Polarare Oberfläche (TPSA) | 76,2 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 336 |
|---|
| Löslichkeit | >39.9 [ug/mL] (The mean of the results at pH 7.4) |
|---|
| Schmelzpunkt | 220-230 °C (sublm) |
|---|
| Siedepunkt | 484.3±47.0 °C(Predicted) |
|---|
| Dichte | 1.319±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 3.46±0.10(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
