HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Chlor-2,4-dinitrobenzol
1-CHLORO-2,4-DINITROBENZENE · Cdnb · Dncb · dinitrochlorobenzene · CDN · BM1-d · 24DNCB · Dinitrochlorobenzol
Identifikatoren & physikalische Daten
| CAS No. | 97-00-7 |
|---|---|
| Summenformel | C6H3ClN2O4 |
| Durchschnittliche Molmasse | 202,55 g/mol |
| Monoisotopische Masse | 201,9781343 g/mol |
| SMILES | O=[N+]([O-])c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChIKey | VYZAHLCBVHPDDF-UHFFFAOYSA-N |
| PubChem CID | 6 |
| ChEMBL | CHEMBL292687 |
| ChEBI | CHEBI:34718 |
| EC No. | 202-551-4 |
| DTXSID | DTXSID6020278 |
| Lokaler Name | 1-Chlor-2,4-dinitrobenzol |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 91,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 224 |
| Schmelzpunkt | 48-50 °C(lit.) |
| Siedepunkt | 315 °C(lit.) |
| Dichte | 314 |
| Dampfdichte | 6.98 (vs air) |
| Dampfdruck | 1 hPa (106 °C) |
| Brechungsindex | 1.5857 |
| Flammpunkt | 367 °F |
| Lagerbedingungen | Store below +30°C. |
| Löslichkeit | alcohol: very slightly soluble (cold)(lit.)insoluble |
| Aggregatzustand | Crystalline Mass, Chunks or Crystals and Powder |
| Farbe | Yellow to brown |
| Geruch | Almond-like |
| Explosionsgrenze | 1.9-22%(V) |
| Merck | 14,2136 |
| BRN | 613161 |
| Henry-Konstante | 3.5×100 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Stabilität | Stable. Combustible. Incompatible with strong oxidizing agents, ammonia. Reacts violently with hydrazine hydrate. |
| InChI | 1S/C6H3ClN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H |
| InChIKey | VYZAHLCBVHPDDF-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Cl)c(c1)[N+]([O-])=O |
| LogP (Verteilungskoeffizient) | 2.24 at 23.3℃ and pH3.5-5.5 |
| CAS Datenbank | 97-00-7(CAS DataBase Reference) |
| NIST chemische Informationen | Benzene, 1-chloro-2,4-dinitro-(97-00-7) |
| EPA chemische Informationen | 2,4-Dinitrochlorobenzene (97-00-7) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 2 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3441 6.1/PG II (CHLORODINITROBENZENES, SOLID) |
| Zollcode | 2904 99 00 |
| RTECS-Nr. | CZ0525000 |
| R-Sätze (R) | 23/24/25-33-50/53-43-41-38 |
| Toxizität | LD50 orally in Rabbit: 640 mg/kg LD50 dermal Rabbit 130 mg/kg |
| Gefahrensymbole | T,N |
| hazard_note | Toxic |
| Sicherheitshinweise (S) | 28-36/37-45-60-61-28A-24 |
| Gefahrenklasse | 6.1Acute Tox. 2 DermalAcute Tox. 4 OralAquatic Acute 1Aquatic Chronic 1Eye Dam. 1Skin Irrit. 2Skin Sens. 1 |
| Verpackungsgruppe | II |
| Lagerklasse | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
| Gefahrstoffdaten | 97-00-7(Hazardous Substances Data) |
| Selbstentzündungstemperatur | 464 °C |
Anwendungen & Verwendung
Verwenden
1-Chloro-2,4-dinitrobenzene is a benzene derivative and is used in biochemical research as a substrate for glutathione S-transferase.