HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,3-Dicyanonaphthalene
,3-Dicyanonaphthalene · 2,3-DICYANONAHTHALENE · 2,3-DICYANONAPHTHALENE · 2,3-Dicyanonaphthalene>2,3-NAPHTHALENEDICARBONITRILE · NAPHTHALENE-2,3-DICARBONITRILE · 2,3-Naphthalenedicarbonitrile,98% · 2 3-NAPHTHALENEDICARBONITRILE 98%
Identifikatoren & physikalische Daten
| CAS No. | 22856-30-0 |
|---|---|
| Summenformel | C12H6N2 |
| Durchschnittliche Molmasse | 178,19 g/mol |
| Monoisotopische Masse | 178,05309819 g/mol |
| SMILES | N#Cc1cc2ccccc2cc1C#N |
| InChIKey | KNBYJRSSFXTESR-UHFFFAOYSA-N |
| PubChem CID | 601270 |
| EC No. | 625-271-8 |
| DTXSID | DTXSID30345032 |
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 47,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 271 |
| Schmelzpunkt | 253-257 °C |
| Siedepunkt | 300.41°C (rough estimate) |
| Dichte | 1.2218 (rough estimate) |
| Brechungsindex | 1.5200 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | slightly sol. in Chloroform |
| Aggregatzustand | powder to crystal |
| Farbe | White to Light yellow |
| BRN | 2574929 |
| Hauptanwendungen | diagnostic assay manufacturinghematologyhistology |
| InChI | InChI=1S/C12H6N2/c13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14/h1-6H |
| InChIKey | KNBYJRSSFXTESR-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(C#N)=C1C#N |
| CAS Datenbank | 22856-30-0(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 3439 |
| Zollcode | 2926907090 |
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xn,Xi |
| Sicherheitshinweise (S) | 36/37-37/39-26 |
| Gefahrenklasse | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2,3-Naphthalenedicarbonitrile is a precursor to a molecular semiconductor. Dyes and metabolites.