HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Adenosin-5'-(trihydrogendiphosphat)
ADENOSINE DIPHOSPHATE · Adenosine 5'-diphosphate · Adenosine 5＇-diphosphate · 5’-adenylphosphoricacid · ADP · ANT 4 · ADP-H · 5'-ADP
Identifikatoren & physikalische Daten
| CAS No. | 58-64-0 |
|---|---|
| Summenformel | C10H15N5O10P2 |
| Durchschnittliche Molmasse | 427,2 g/mol |
| Monoisotopische Masse | 427,02941569 g/mol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChIKey | XTWYTFMLZFPYCI-KQYNXXCUSA-N |
| PubChem CID | 6022 |
| ChEMBL | CHEMBL14830 |
| ChEBI | CHEBI:16761 |
| EC No. | 200-392-5 |
| DTXSID | DTXSID60883210 |
| Lokaler Name | Adenosin-5'-(trihydrogendiphosphat) |
Chemische & physikalische Eigenschaften
| XLogP | -4,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 233 |
| H-Brücken-Donoren | 6 |
| H-Brücken-Akzeptoren | 14 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 27 |
| Formalladung | 0 |
| Komplexität | 637 |
| Schmelzpunkt | >145oC (dec.) |
| Siedepunkt | 196°C |
| Dichte | 2.49±0.1 g/cm3(Predicted) |
| Lagerbedingungen | -20°C |
| Löslichkeit | DMSO (Slightly, Heated), Methanol (Slightly), Water (Slightly) |
| pKa (Säurekonstante) | pK2: 4.2(-1)pK3: 7.20(-2) (25°C) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
| Merck | 13,155 |
| BRN | 67722 |
| InChIKey | XTWYTFMLZFPYCI-KQYNXXCUSA-N |
| SMILES | C(OP(=O)(O)OP(O)(O)=O)[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](O)[C@@H]1O |
| EPA chemische Informationen | Adenosine 5'-(trihydrogen diphosphate) (58-64-0) |
Sicherheit & Vorschriften
| F | 10-21 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29349990 |
| RTECS-Nr. | AU7467000 |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Adenosine 5′-diphosphate (5′-ADP or ADP) was used as a test compound for studying the endothelium-dependent vascular response in salt sensitive (DS) and salt resistant Dahl rats (DR). The product was used to study the different P2-purinergic receptor subtypes on canine vascular smooth muscle and endothelium.