Folsure
PGA · Folate · Vitamin B · Vitamin B9 · folic · FOLIC ACID HYDRATE · PTEROYLGLUTAMIC ACID · Vitamin B11
Identifikatoren & physikalische Daten
| CAS No. | 59-30-3 |
|---|---|
| Summenformel | C19H19N7O6 |
| Durchschnittliche Molmasse | 441,4 g/mol |
| Monoisotopische Masse | 441,13968133 g/mol |
| SMILES | Nc1nc(=O)c2nc(CNc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cnc2[nH]1 |
| InChIKey | OVBPIULPVIDEAO-LBPRGKRZSA-N |
| PubChem CID | 6037 |
| DTXSID | DTXSID0022519 |
| Lokaler Name | Folsure |
Chemische & physikalische Eigenschaften
| XLogP | -1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 209 |
| H-Brücken-Donoren | 6 |
| H-Brücken-Akzeptoren | 9 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 32 |
| Formalladung | 0 |
| Komplexität | 767 |
| Löslichkeit | 0.0016 mg/mLboiling water: soluble1%1.6 mg/L (25 ºC) |
| Schmelzpunkt | 250 °C |
| Physical Description | Solid |
| Collision Cross Section | 201.3 Ų [M-2H+Na]- |
| Siedepunkt | 552.35°C (rough estimate) |
| Dichte | 1.4704 (rough estimate) |
| Brechungsindex | 1.6800 (estimate) |
| Lagerbedingungen | 2-8°C |
| pKa (Säurekonstante) | pKa 2.5 (Uncertain) |
| Aggregatzustand | Crystalline Powder |
| Farbe | Yellow to orange |
| Geruch | Odorless |
| pH | 4.0-4.8 (25°C, 100g/L in H2O) |
| Biologische Quelle | synthetic (organic) |
| Merck | 14,4221 |
| BRN | 100781 |
| BCS Class | 3 |
| Stabilität | Stable. Incompatible with heavy metal ions, strong oxidizing agents, strong reducing agents. Solutions may be light and heat sensitive. |
| Kosmetik-Inhaltsstoffe Funktionen | SKIN CONDITIONING |
| InChIKey | OVBPIULPVIDEAO-LBPRGKRZSA-N |
| SMILES | NC(N1)=NC(C2=C1N=CC(CNC3=CC=C(C(N[C@@H](CCC(O)=O)C(O)=O)=O)C=C3)=N2)=O |
| LogP (Verteilungskoeffizient) | -0.990 (est) |
| CAS Datenbank | 59-30-3(CAS DataBase Reference) |
| NIST chemische Informationen | Folic acid(59-30-3) |
| EPA chemische Informationen | L-Glutamic acid, N-[4-[[(2-amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]- (59-30-3) |
Sicherheit & Vorschriften
| F | 8 |
|---|---|
| Wassergefährdungsklasse (WGK) | 1 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29362900 |
| RTECS-Nr. | LP5425000 |
| R-Sätze (R) | 33-62-68 |
| Toxizität | A water soluble vitamin required in the diet of mammals. Sulfonamide drugs are selectively toxic to bacteria because they inhibit the incorporation of p-aminobenzoic acid into folic acid, a biosynthetic process in bacteria. Folic acid deficiency adversely affects prenatal development in humans. Dietary supplementation with folic acid dramatically reduces the incidence of neural tube defects in humans. Folic acid deficiency may also contribute to the causes of megaloblastic macrocytic anemia and a consequence of this is that this disease can be induced, as a side effect, when methotrexate, a folic acid antagonist, is used in cancer chemotherapy |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 59-30-3(Hazardous Substances Data) |
Anwendungen & Verwendung
Beschreibung
Folic acid is an essential B vitamin. It is converted to folate in vivo, which is a necessary cofactor for a variety of biological processes, including nucleotide synthesis and, thus, DNA synthesis and repair, among others. A deficiency in dietary folic acid can lead to a range of developmental and cognitive disorders, most prominently neural tube defects and congenital heart defects.
Occurrence
Synthetic
Verwenden
folic acid is generally used as an emollient. In vitro and in vivo skin studies now indicate its capacity to aid in DnA synthesis and repair, promote cellular turnover, reduce wrinkles, and promote skin firmness. There is some indication that folic acid may also protect DnA from uV-induced damage. Folic acid is a member of the vitamin B complex and is naturally occurring in leafy greens.