HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-(1-Isocyanato-1-methylethyl)-3-(1-methylethenyl)benzene
m-tmi · m-tetramethylxyleneisocyanate · 3-ISOPROPENYLCUMYL ISOCYANATE · 3-Isopropenyl-7-isocyanatocumene · ISOCYANIC ACID 3-ISOPROPENYLCUMYL ESTER · 3-isopropenyl-N-isopropylidene-benzamide · 3-Isopropenyl-alpha,alpha-dimethylbenzyl · 3-isopropenyl-α,α-dimethylbenzyl isocyanate
Identifikatoren & physikalische Daten
| CAS No. | 2094-99-7 |
|---|---|
| Summenformel | C13H15NO |
| Durchschnittliche Molmasse | 201,26 g/mol |
| Monoisotopische Masse | 201,1153641 g/mol |
| SMILES | C=C(C)c1cccc(C(C)(C)N=C=O)c1 |
| InChIKey | ZVEMLYIXBCTVOF-UHFFFAOYSA-N |
| PubChem CID | 604152 |
| ChEMBL | CHEMBL3184458 |
| EC No. | 402-440-2 |
| DTXSID | DTXSID9044871 |
Chemische & physikalische Eigenschaften
| XLogP | 4,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 29,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 287 |
| Siedepunkt | 268-271 °C(lit.) |
| Dichte | 1.018 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.53(lit.) |
| Flammpunkt | >230 °F |
| Aggregatzustand | clear liquid |
| Farbe | Colorless to Almost colorless |
| InChI | 1S/C13H15NO/c1-10(2)11-6-5-7-12(8-11)13(3,4)14-9-15/h5-8H,1H2,2-4H3 |
| InChIKey | ZVEMLYIXBCTVOF-UHFFFAOYSA-N |
| SMILES | CC(=C)c1cccc(c1)C(C)(C)N=C=O |
| CAS Datenbank | 2094-99-7(CAS DataBase Reference) |
| EPA chemische Informationen | m-Isopropenyl cumyl isocyanate (2094-99-7) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 2 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2206 6.1/PG 3 |
| Zollcode | 2929.10.8090 |
| RTECS-Nr. | DA3685000 |
| R-Sätze (R) | 26-34-42/43-48/20-50/53 |
| Gefahrensymbole | T+,N |
| Sicherheitshinweise (S) | 7-15-28-36/37/39-38-45-60-61 |
| Gefahrenklasse | 6.1(a)Acute Tox. 2 InhalationAquatic Acute 1Aquatic Chronic 1Eye Dam. 1Resp. Sens. 1Skin Corr. 1BSkin Sens. 1STOT RE 2 Inhalation |
| Verpackungsgruppe | II |
| Lagerklasse | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
| Selbstentzündungstemperatur | 838 °F |
Anwendungen & Verwendung
Verwenden
m-TMI can be used as a tetrafunctional isocyanate which can further be used in the development of polymer electrolyte. It can be used as a coupling agent in the preparation of jute reinforced polypropylene.