HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Amino-3,5-dichloro-2,6-lutidine
3,5-dichloro-2,6-dimethyl-4-Pyridinamine · 3,5-Dichloro-2,6-dimethylpyridin-4-amine · 4-PyridinaMine, 3,5-dichloro-2,6-diMethyl-
Identifikatoren & physikalische Daten
| CAS No. | 50978-40-0 |
|---|---|
| Summenformel | C7H8Cl2N2 |
| Durchschnittliche Molmasse | 191,05 g/mol |
| Monoisotopische Masse | 190,0064537 g/mol |
| SMILES | Cc1nc(C)c(Cl)c(N)c1Cl |
| InChIKey | IKNQBQLXQVSYRN-UHFFFAOYSA-N |
| PubChem CID | 605477 |
| DTXSID | DTXSID30345557 |
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 38,9 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 128 |
| InChI | InChI=1S/C7H8Cl2N2/c1-3-5(8)7(10)6(9)4(2)11-3/h1-2H3,(H2,10,11) |
| InChIKey | IKNQBQLXQVSYRN-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(C)=C(Cl)C(N)=C1Cl |
Sicherheit & Vorschriften
| Regulatorische Informationen | Chemical: 4-Pyridinamine, 3,5-dichloro-2,6-dimethyl- |
|---|---|
| Weitere Sicherheitsinformationen | Evaluation - Chemicals not considered for in depth evaluation - Not commercially active in Australia |
| Zollcode | 2933399990 |
Anwendungen & Verwendung
Verwenden
3,5-Dichloro-2,6-dimethylpyridin-4-amine is an impurity of Clopidol (C587285) which is an antibiotic used in veterinary medicine as a coccidiostat in poultry. Showed low order of acute and chronic toxicity in animals.