HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 607208Erstellt: 27. Oktober 2026
7-Nitro-2,3-dihydro-1,4-benzodioxin-6-amine
7-Nitro-2,3-dihydrobenzo[b][1,4]dioxin-6-amine
https://huagongshe.com/de/chemical/607208
Identifikatoren & physikalische Daten
| CAS No. | 62140-78-7 |
|---|
| Summenformel | C8H8N2O4 |
|---|
| Durchschnittliche Molmasse | 196,16 g/mol |
|---|
| Monoisotopische Masse | 196,04840674 g/mol |
|---|
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])OCCO2 |
|---|
| InChIKey | FPLCYUDKBMTETP-UHFFFAOYSA-N |
|---|
| PubChem CID | 607208 |
|---|
| ChEMBL | CHEMBL1477705 |
|---|
| EC No. | 988-982-5 |
|---|
| DTXSID | DTXSID80345800 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,3 |
|---|
| Polarare Oberfläche (TPSA) | 90,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 230 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (33.3%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (33.3%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
