Identifikatoren & physikalische Daten
| CAS No. | 138982-67-9 |
|---|
| Summenformel | C21H24Cl2N4O2S |
|---|
| Durchschnittliche Molmasse | 467,4 g/mol |
|---|
| Monoisotopische Masse | 466,09970237 g/mol |
|---|
| SMILES | Cl.O.O=C1Cc2cc(CCN3CCN(c4nsc5ccccc45)CC3)c(Cl)cc2N1 |
|---|
| InChIKey | ZCBZSCBNOOIHFP-UHFFFAOYSA-N |
|---|
| PubChem CID | 60853 |
|---|
| ChEMBL | CHEMBL1375743 |
|---|
| DTXSID | DTXSID00160855 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 77,7 |
|---|
| H-Brücken-Donoren | 3 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 30 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 573 |
|---|
Sicherheit & Vorschriften
| Regulatorische Informationen | Ziprasidone hydrochloride monohydrate: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|
