HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5,7-Dichlorothiazolo(5,4-d)pyrimidine
5,7-dichlorothiazolo[5,4-d]pyrimidine · Thiazolo[5,4-d]pyrimidine, 5,7-dichloro- · 5,7-dichloro-[1,3]thiazolo[5,4-d]pyriMidine
Identifikatoren & physikalische Daten
| CAS No. | 13479-88-4 |
|---|---|
| Summenformel | C5HCl2N3S |
| Durchschnittliche Molmasse | 206,05 g/mol |
| Monoisotopische Masse | 204,9268236 g/mol |
| SMILES | Clc1nc(Cl)c2ncsc2n1 |
| InChIKey | XYBGDWLYHQAUQM-UHFFFAOYSA-N |
| PubChem CID | 609639 |
| EC No. | 875-907-5 |
| DTXSID | DTXSID70346104 |
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 159 |
| Schmelzpunkt | 148.5-149.5 °C |
| Siedepunkt | 281.2±22.0 °C(Predicted) |
| Dichte | 1.767±0.06 g/cm3(Predicted) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| Löslichkeit | DMF: 2 mg/ml,DMSO: 1 mg/ml,Ethanol: insol,PBS (pH 7.2): insol |
| Aggregatzustand | A solid |
| pKa (Säurekonstante) | -2.68±0.50(Predicted) |
| Farbe | Light yellow to brown |
| InChI | InChI=1S/C5HCl2N3S/c6-3-2-4(11-1-8-2)10-5(7)9-3/h1H |
| InChIKey | XYBGDWLYHQAUQM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=C2N=CSC2=N1 |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
5,7-Dichlorothiazolo[5,4-d]pyrimidine was used in studies to prepare Kinase inhibitors.