HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 613486Erstellt: 2. November 2026
5-(4-Chlorophenyl)thiophene-2-carboxylic acid
2-Thiophenecarboxylic acid, 5-(4-chlorophenyl)- · JR-8022, 5-(4-Chlorophenyl)thiophene-2-carboxylic acid, 97%
https://huagongshe.com/de/chemical/613486
Identifikatoren & physikalische Daten
| CAS No. | 40133-14-0 |
|---|
| Summenformel | C11H7ClO2S |
|---|
| Durchschnittliche Molmasse | 238,69 g/mol |
|---|
| Monoisotopische Masse | 237,98552814 g/mol |
|---|
| SMILES | O=C(O)c1ccc(-c2ccc(Cl)cc2)s1 |
|---|
| InChIKey | GWLCYLPZQKOCTB-UHFFFAOYSA-N |
|---|
| PubChem CID | 613486 |
|---|
| EC No. | 999-093-7 |
|---|
| DTXSID | DTXSID20346593 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|
| Polarare Oberfläche (TPSA) | 65,5 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 239 |
|---|
| Schmelzpunkt | 254 °C |
|---|
| Siedepunkt | 418.7±35.0 °C(Predicted) |
|---|
| Dichte | 1.415±0.06 g/cm3(Predicted) |
|---|
| Lagerbedingungen | 2-8°C |
|---|
| pKa (Säurekonstante) | 3.39±0.10(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
