HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 6198Erstellt: 27. Oktober 2026
1H-Indole-3-ethanamine, 5-methoxy-, hydrochloride (1:?)
https://huagongshe.com/de/chemical/6198
Identifikatoren & physikalische Daten
| CAS No. | 17107-33-4 |
|---|
| Summenformel | C11H15ClN2O |
|---|
| Durchschnittliche Molmasse | 226,7 g/mol |
|---|
| Monoisotopische Masse | 226,08729078 g/mol |
|---|
| SMILES | COc1ccc2[nH]cc(CCN)c2c1.Cl |
|---|
| InChIKey | TXVAYRSEKRMEIF-UHFFFAOYSA-N |
|---|
| PubChem CID | 6198 |
|---|
| ChEMBL | CHEMBL1256138 |
|---|
| EC No. | 200-637-6 |
|---|
| DTXSID | DTXSID801017272 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 51 |
|---|
| H-Brücken-Donoren | 3 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 186 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
