HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 62080Erstellt: 3. November 2026
Octylglucosid
OCTYL GLUCOSIDE · (2R,3S,4S,5R)-2-(hydroxyMethyl)-6-(octyloxy)tetrahydro-2H-pyran-3,4,5-triol
https://huagongshe.com/de/chemical/62080
Identifikatoren & physikalische Daten
| CAS No. | 41444-50-2 |
|---|
| Summenformel | C14H28O6 |
|---|
| Durchschnittliche Molmasse | 292,37 g/mol |
|---|
| Monoisotopische Masse | 292,18858861 g/mol |
|---|
| SMILES | CCCCCCCCOC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
|---|
| InChIKey | HEGSGKPQLMEBJL-RQICVUQASA-N |
|---|
| PubChem CID | 62080 |
|---|
| EC No. | 255-367-1 |
|---|
| DTXSID | DTXSID1042235 |
|---|
| Lokaler Name | Octylglucosid |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,4 |
|---|
| Polarare Oberfläche (TPSA) | 99,4 |
|---|
| H-Brücken-Donoren | 4 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 9 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 250 |
|---|
| Stoffklassen | Biological Agents -> Monosaccharides and Derivatives |
|---|
| Siedepunkt | 454.1±45.0 °C(Predicted) |
|---|
| Dichte | 1.18±0.1 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 12.95±0.70(Predicted) |
|---|
| EPA chemische Informationen | Octyl D-glucopyranoside (41444-50-2) |
|---|
Sicherheit & Vorschriften
| Regulatorische Informationen | D-Glucoside, octyl: Does not have an individual approval but may be used under an appropriate group standard |
|---|
| Gefahrenübersicht | See n-Octyl-beta-D-glucoside. |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
