HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 62081Erstellt: 3. November 2026
p-tert-Butylphenol, bisphenol A, formaldehyde resin
Bisphenol A, p-tert-butyl phenol, formaldehyde polymer · Formaldehyde, polymer with 4-(1,1-dimethylethyl)phenol and 4,4-(1-methylethylidene)bisphenol
https://huagongshe.com/de/chemical/62081
Identifikatoren & physikalische Daten
| CAS No. | 54579-44-1 |
|---|
| Summenformel | C26H32O4 |
|---|
| Durchschnittliche Molmasse | 408,5 g/mol |
|---|
| Monoisotopische Masse | 408,2300595 g/mol |
|---|
| SMILES | C=O.CC(C)(C)c1ccc(O)cc1.CC(Cc1ccc(O)cc1)c1ccc(O)cc1 |
|---|
| InChIKey | GMYVHTDGZSUUQL-UHFFFAOYSA-N |
|---|
| PubChem CID | 62081 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 77,8 |
|---|
| H-Brücken-Donoren | 3 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 30 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 330 |
|---|
| EPA chemische Informationen | Bisphenol A p-tert-butylphenol formaldehyde polymer (54579-44-1) |
|---|
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|
