Identifikatoren & physikalische Daten
| CAS No. | 499-69-4 |
|---|
| Summenformel | C10H20O |
|---|
| Durchschnittliche Molmasse | 156,26 g/mol |
|---|
| Monoisotopische Masse | 156,15141526 g/mol |
|---|
| SMILES | CC(C)[C@@H]1CC[C@@H](C)[C@H](O)C1 |
|---|
| InChIKey | ULJXKUJMXIVDOY-OPRDCNLKSA-N |
|---|
| PubChem CID | 62350 |
|---|
| EC No. | 207-885-4 |
|---|
| DTXSID | DTXSID90198147 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|
| Polarare Oberfläche (TPSA) | 20,2 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 11 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 120 |
|---|
| Lebensmittelzusatzstoffe | FLAVORING AGENT OR ADJUVANT -> FDA Substance added to food |
|---|
| Dichte | 0.887-0.893 |
|---|
| Aromastoffe | EU Flavoring substances |
|---|
| Löslichkeit | (in ethanol) |
|---|
| Siedepunkt | 222 °C |
|---|
| Brechungsindex | 1.462-1.463 |
|---|
Sicherheit & Vorschriften
| Regulatorische Informationen | Chemical: Cyclohexanol, 2-methyl-5-(1-methylethyl)-, (1.alpha.,2.beta.,5.alpha.)-Cyclohexanol, 2-methyl-5-(1-methylethyl)-, (1R,2R,5R)-rel-: Does not have an individual approval but may be used under an appropriate group standard |
|---|
| Weitere Sicherheitsinformationen | Evaluation - Chemicals that are unlikely to require further regulation to manage risks to human health |
|---|
