HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 63201Erstellt: 4. November 2026
4(3H)-Quinazolinone, 3-(3-chloro-2-methylphenyl)-2-methyl-
3-(3-Chloro-o-tolyl)-2-methyl-4(3H)-quinazolone · 4(3H)-Quinazolinone, 3-(3-chloro-2-methylphenyl)-2-methyl-
https://huagongshe.com/de/chemical/63201
Identifikatoren & physikalische Daten
| CAS No. | 1915-77-1 |
|---|
| Summenformel | C16H13ClN2O |
|---|
| Durchschnittliche Molmasse | 284,74 g/mol |
|---|
| Monoisotopische Masse | 284,0716407 g/mol |
|---|
| SMILES | Cc1c(Cl)cccc1-n1c(C)nc2ccccc2c1=O |
|---|
| InChIKey | MCCICLHYQKULJG-UHFFFAOYSA-N |
|---|
| PubChem CID | 63201 |
|---|
| EC No. | 653-089-9 |
|---|
| DTXSID | DTXSID20172672 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|
| Polarare Oberfläche (TPSA) | 32,7 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 423 |
|---|
| Schmelzpunkt | 143-145 °C |
|---|
| Siedepunkt | 447.3±55.0 °C(Predicted) |
|---|
| Dichte | 1.26±0.1 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 2.07±0.70(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
| Alarmwort | Achtung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H301 |
|---|
