Identifikatoren & physikalische Daten
| CAS No. | 71989-35-0 |
|---|
| Summenformel | C23H27NO5 |
|---|
| Durchschnittliche Molmasse | 397,5 g/mol |
|---|
| Monoisotopische Masse | 397,18892296 g/mol |
|---|
| SMILES | C[C@@H](OC(C)(C)C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
| InChIKey | LZOLWEQBVPVDPR-VLIAUNLRSA-N |
|---|
| PubChem CID | 6364643 |
|---|
| DTXSID | DTXSID501218229 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4 |
|---|
| Polarare Oberfläche (TPSA) | 84,9 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 8 |
|---|
| Schwere Atome | 29 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 564 |
|---|
Sicherheit & Vorschriften
| Regulatorische Informationen | L-Threonine, O-(1,1-dimethylethyl)-N-(9H-fluoren-9-ylmethoxy)carbonyl-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|
