Identifikatoren & physikalische Daten
| CAS No. | 1788-96-1 |
|---|
| Summenformel | C15H11N3O3 |
|---|
| Durchschnittliche Molmasse | 281,27 g/mol |
|---|
| Monoisotopische Masse | 281,08004122 g/mol |
|---|
| SMILES | Cc1nc2ccccc2c(=O)n1-c1ccc([N+](=O)[O-])cc1 |
|---|
| InChIKey | YOHKWEFKBJNRBR-UHFFFAOYSA-N |
|---|
| PubChem CID | 63708 |
|---|
| ChEMBL | CHEMBL580891 |
|---|
| DTXSID | DTXSID90275684 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|
| Polarare Oberfläche (TPSA) | 78,5 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 463 |
|---|
| Löslichkeit | >42.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
