HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(E)-4-Methoxy-3-buten-2-on
4-methoxy-3-butene-2-one · TRANS-4-METHOXY-3-BUTEN-2-ONE · Einecs 257-364-0 · 4-Methoxy-3-buten-2-one · Trans 4-Methoxy Butenone · (E)-4-methoxy-3-buten-2-one · (3E)-4-Methoxy-3-buten-2-one · (3E)-4-Methoxybut-3-en-2-one
Identifikatoren & physikalische Daten
| CAS No. | 51731-17-0 |
|---|---|
| Summenformel | C5H8O2 |
| Durchschnittliche Molmasse | 100,12 g/mol |
| Monoisotopische Masse | 100,05242949 g/mol |
| SMILES | CO/C=C/C(C)=O |
| InChIKey | VLLHEPHWWIDUSS-ONEGZZNKSA-N |
| PubChem CID | 639675 |
| EC No. | 257-364-0 |
| DTXSID | DTXSID501308458 |
| Lokaler Name | (E)-4-Methoxy-3-buten-2-on |
Chemische & physikalische Eigenschaften
| XLogP | 0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 7 |
| Formalladung | 0 |
| Komplexität | 84,1 |
| Schmelzpunkt | 0℃ |
| Siedepunkt | 200 °C (lit.) |
| Dichte | 0.982 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.468(lit.) |
| Flammpunkt | 146 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | sol THF, ether, acetonitrile, benzene. |
| Aggregatzustand | liquid |
| BRN | 2070991 |
| InChI | InChI=1S/C5H8O2/c1-5(6)3-4-7-2/h3-4H,1-2H3/b4-3+ |
| InChIKey | VLLHEPHWWIDUSS-ONEGZZNKSA-N |
| SMILES | CC(=O)/C=C/OC |
Sicherheit & Vorschriften
| F | 10-21 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 1224 |
| R-Sätze (R) | 10 |
| Sicherheitshinweise (S) | 23-24/25 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
4-Methoxy-3-buten-2-one is a versatile four-carbon synthon; precursor to the Danishefsky diene; Diels-Alder dienophile; dipolarophile; electrophilic four-carbon synthon subject to conjugate addition at C-4 followed by elimination of the methoxide anion; its enolate is a nucleophilic four-carbon building block.