HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(5S)-5-methyl-5-phenylimidazolidine-2,4-dione
(S)-5-Methyl-5-phenylimidazolidine-2,4-dione · (5S)-5-methyl-5-phenylimidazolidine-2,4-dione
Identifikatoren & physikalische Daten
| CAS No. | 27539-12-4 |
|---|---|
| Summenformel | C10H10N2O2 |
| Durchschnittliche Molmasse | 190,2 g/mol |
| Monoisotopische Masse | 190,07422756 g/mol |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)NC1=O |
| InChIKey | JNGWGQUYLVSFND-JTQLQIEISA-N |
| PubChem CID | 640021 |
| EC No. | 155-789-5 |
| DTXSID | DTXSID601028320 |
Chemische & physikalische Eigenschaften
| XLogP | 1 |
|---|---|
| Polarare Oberfläche (TPSA) | 58,2 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 271 |
| Pestizide | Environmental transformation -> Pesticide transformation products (metabolite, successor) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Alarmwort | Warnung |
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
(S)-5-Methyl-5-phenylhydantoin is an intermediate used to prepare Fenamidone as a foliar fungicide used on grapes, ornamentals, potatoes, tobacco, and vegetables. It exerts its fungicidal effects by acting as a Qo inhibitor.