Identifikatoren & physikalische Daten
| CAS No. | 53684-55-2 |
|---|
| Summenformel | C14H12N4 |
|---|
| Durchschnittliche Molmasse | 236,27 g/mol |
|---|
| Monoisotopische Masse | 236,1061964 g/mol |
|---|
| SMILES | c1ccc(Nc2n[nH]nc2-c2ccccc2)cc1 |
|---|
| InChIKey | ACLZPKMBZBHXJZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 6401302 |
|---|
| ChEMBL | CHEMBL1345333 |
|---|
| EC No. | 688-681-6 |
|---|
| DTXSID | DTXSID40423294 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|
| Polarare Oberfläche (TPSA) | 53,6 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 246 |
|---|
| LogP (Verteilungskoeffizient) | 3.37 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
