HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Nitroadamantane
NSC 235788 · NSC 130990 · 1-NITROADAMANTANE · Adamantane, 1-nitro- · Tricyclo[3.3.1.1(3,7)]decane, 1-nitro- · 1-NitroadamantaneQ: What is 1-Nitroadamantane Q: What is the CAS Number of 1-Nitroadamantane Q: What is the storage condition of 1-Nitroadamantane
Identifikatoren & physikalische Daten
| CAS No. | 7575-82-8 |
|---|---|
| Summenformel | C10H15NO2 |
| Durchschnittliche Molmasse | 181,23 g/mol |
| Monoisotopische Masse | 181,11027872 g/mol |
| SMILES | O=[N+]([O-])C12CC3CC(CC(C3)C1)C2 |
| InChIKey | HONLSNLUVRQMEK-UHFFFAOYSA-N |
| PubChem CID | 64165 |
| DTXSID | DTXSID30226650 |
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 45,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 215 |
| Kovats Retention Index | 1500 |
| Schmelzpunkt | 159℃ |
| Siedepunkt | 277.1±7.0℃ (760 Torr) |
| Dichte | 1.19±0.1 g/cm3 (20 ºC 760 Torr) |
| Flammpunkt | 121.8±11.0℃ |
| Lagerbedingungen | -20°C Freezer, Under inert atmosphere |
| Löslichkeit | Chloroform (Slightly), Methanol (Sparingly) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
Sicherheit & Vorschriften
| Gefahrenklasse | IRRITANT |
|---|
Anwendungen & Verwendung
Verwenden
1-Nitroadamantane is a biologically active polycycloalkane that exhibits antiviral activities and as well as inhibitory activities towards the poliferation of lymphocytes.