HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-(4-Brom-3,5-dimethoxyphenyl)-2-(methoxymethyl)acrylonitril
Einecs 260-236-7 · 3-(4-Bromo-3,5-dimethoxyphenyl)-2-methoxymethylpropenenitrile · 3-(4-bromo-3,5-dimethoxyphenyl)-2-(methoxymethyl)acrylonitrile · 3-(4-BroMo-3,5-diMethoxyphenyl)-2-(MethoxyMethyl)-2-propenenitrile · 2-Propenenitrile, 3-(4-bromo-3,5-dimethoxyphenyl)-2-(methoxymethyl)-
Identifikatoren & physikalische Daten
| CAS No. | 56518-39-9 |
|---|---|
| Summenformel | C13H14BrNO3 |
| Durchschnittliche Molmasse | 312,16 g/mol |
| Monoisotopische Masse | 311,01571 g/mol |
| SMILES | COC/C(C#N)=C\c1cc(OC)c(Br)c(OC)c1 |
| InChIKey | FZVLRBPIBXTWKY-WMZJFQQLSA-N |
| PubChem CID | 6436615 |
| EC No. | 260-236-7 |
| Lokaler Name | 3-(4-Brom-3,5-dimethoxyphenyl)-2-(methoxymethyl)acrylonitril |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 51,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 322 |
| Löslichkeit | Dimethyl Sulfoxide |
| Aggregatzustand | Crystals |
| Farbe | Yellow |
Anwendungen & Verwendung
Verwenden
Intermediate in the synthesis of Brodimoprim (B678100).