HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Tetrahydroxybernsteinsure
DIKETOSUCCINIC ACID · Tartrazine Impurity 7 · Tartrazine Impurity 8 · Dihydroxytartanic acid · Dihydroxytartaric acid · tetrahydroxysuccinicacid · Tetrahydroxy-succinicacid · Tartaric Acid Impurity 10
Identifikatoren & physikalische Daten
| CAS No. | 76-30-2 |
|---|---|
| Summenformel | C4H6O8 |
| Durchschnittliche Molmasse | 182,09 g/mol |
| Monoisotopische Masse | 182,00626715 g/mol |
| SMILES | O=C(O)C(O)(O)C(O)(O)C(=O)O |
| InChIKey | XHWHHMNORMIBBB-UHFFFAOYSA-N |
| PubChem CID | 6439 |
| EC No. | 200-951-3 |
| DTXSID | DTXSID10226895 |
| Lokaler Name | Tetrahydroxybernsteinsure |
Chemische & physikalische Eigenschaften
| XLogP | -3,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 156 |
| H-Brücken-Donoren | 6 |
| H-Brücken-Akzeptoren | 8 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 191 |
| Schmelzpunkt | ~114-115° with decompn |
| Siedepunkt | 235.45°C (rough estimate) |
| Dichte | 1.6886 (rough estimate) |
| Brechungsindex | 1.7390 (estimate) |
| pKa (Säurekonstante) | 1.92(at 25℃) |
| pH | 3.04(1 mM solution)2.2(10 mM solution)1.54(100 mM solution) |
Anwendungen & Verwendung
Verwenden
As a reagent for the determination of sodium.