HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2',3'-Dideoxyuridine
DDU · 2',3'-ddU · 2,3’-Dideoxyuridine · 2',3'-Dideoxyuridine · 2',3'-Dideoxy-D-uridine · Uridine, 2',3'-dideoxy- · 2',3'-Dideoxyuridine 98% · BETA-D-2',3'-DIDEOXYURIDINE
Identifikatoren & physikalische Daten
| CAS No. | 5983-09-5 |
|---|---|
| Summenformel | C9H12N2O4 |
| Durchschnittliche Molmasse | 212,2 g/mol |
| Monoisotopische Masse | 212,07970686 g/mol |
| SMILES | O=c1ccn([C@H]2CC[C@@H](CO)O2)c(=O)[nH]1 |
| InChIKey | BTOTXLJHDSNXMW-POYBYMJQSA-N |
| PubChem CID | 65161 |
| ChEMBL | CHEMBL1468 |
| ChEBI | CHEBI:183866 |
| DTXSID | DTXSID90208558 |
Chemische & physikalische Eigenschaften
| XLogP | -0,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 78,9 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 315 |
| Schmelzpunkt | 127-129 °C(lit.) |
| Dichte | 1.397±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Sealed in dry,2-8°C |
| Löslichkeit | DMF: 10 mg/mlDMSO: 10 mg/mlEthanol: Slightly solublePBS (pH 7.2): 5 mg/ml |
| Aggregatzustand | A solid |
| pKa (Säurekonstante) | 9.39±0.10(Predicted) |
| Farbe | White to off-white |
| BRN | 750592 |
| InChI | InChI=1S/C9H12N2O4/c12-5-6-1-2-8(15-6)11-4-3-7(13)10-9(11)14/h3-4,6,8,12H,1-2,5H2,(H,10,13,14)/t6-,8+/m0/s1 |
| InChIKey | BTOTXLJHDSNXMW-POYBYMJQSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=CC(=O)NC2=O)CC1 |
| CAS Datenbank | 5983-09-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| F | 10-23 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29349990 |
| R-Sätze (R) | 34-36/37 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 22-24/25-45-36/37/39-27-26 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2’,3’-Dideoxyuridine can be used as prodrug precursors or in antisense oligonucleotide synthesis. Also, it can be used to synthesize ProTide derivatives and evaluated against HIV-1 and HIV-2.