HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Milenperon
R-34009 · milenperone · 5-Chloro-1-[3-[4-(4-fluorobenzoyl)piperidino]propyl]-1,3-dihydro-2H-benzimidazol-2-one · 5-Chloro-1-[3-[4-(4-fluorobenzoyl)-1-piperidinyl]propyl]-1,3-dihydro-2H-benziMidazol-2-one · 2H-Benzimidazol-2-one, 5-chloro-1-[3-[4-(4-fluorobenzoyl)-1-piperidinyl]propyl]-1,3-dihydro-
Identifikatoren & physikalische Daten
| CAS No. | 59831-64-0 |
|---|---|
| Summenformel | C22H23ClFN3O2 |
| Durchschnittliche Molmasse | 415,9 g/mol |
| Monoisotopische Masse | 415,14628288 g/mol |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCCn2c(=O)[nH]c3cc(Cl)ccc32)CC1 |
| InChIKey | DBESQBZOXMCXPV-UHFFFAOYSA-N |
| PubChem CID | 65489 |
| ChEMBL | CHEMBL2106976 |
| EC No. | 261-947-5 |
| DTXSID | DTXSID60208560 |
| Lokaler Name | Milenperon |
Chemische & physikalische Eigenschaften
| XLogP | 3,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 52,7 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 29 |
| Formalladung | 0 |
| Komplexität | 591 |
| Schmelzpunkt | >125°C (dec.) |
| Lagerbedingungen | -20°C Freezer, Under inert atmosphere |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
Anwendungen & Verwendung
Verwenden
A specific serotonin-S2 antagonist. A selective drug for the control of behavioral disorders in epileptic and alcoholic patients.